C22H28N4O5 — CID 3384476
2-amino-4,4-dipropoxy-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3384476) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-amino-4,4-dipropoxy-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-dipropoxy-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3384476 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-amino-4,4-dipropoxy-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCOC1(OCCC)N=C(N)C2(C#N)C(c3c(OC)cc(OC)cc3OC)C12C#N |
| InChI | InChI=1S/C22H28N4O5/c1-6-8-30-22(31-9-7-2)21(13-24)18(20(21,12-23)19(25)26-22)17-15(28-4)10-14(27-3)11-16(17)29-5/h10-11,18H,6-9H2,1-5H3,(H2,25,26) |
| InChIKey | RBKCUTVXQLRXLV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|