C19H21BrN4O2 — CID 3355342
2-amino-6-(3-bromophenyl)-4,4-dipropoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3355342) has the molecular formula C19H21BrN4O2 and a molecular weight of 417.31 g/mol. Its IUPAC name is 2-amino-6-(3-bromophenyl)-4,4-dipropoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-6-(3-bromophenyl)-4,4-dipropoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3355342 |
| Molecular Formula | C19H21BrN4O2 |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-amino-6-(3-bromophenyl)-4,4-dipropoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCOC1(OCCC)N=C(N)C2(C#N)C(c3cccc(Br)c3)C12C#N |
| InChI | InChI=1S/C19H21BrN4O2/c1-3-8-25-19(26-9-4-2)18(12-22)15(13-6-5-7-14(20)10-13)17(18,11-21)16(23)24-19/h5-7,10,15H,3-4,8-9H2,1-2H3,(H2,23,24) |
| InChIKey | CGXJEBDMAITORM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|