C20H25N5O2 — CID 3359100
2-amino-4,4-dibutoxy-6-pyridin-3-yl-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3359100) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-amino-4,4-dibutoxy-6-pyridin-3-yl-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-dibutoxy-6-pyridin-3-yl-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3359100 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-amino-4,4-dibutoxy-6-pyridin-3-yl-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCOC1(OCCCC)N=C(N)C2(C#N)C(c3cccnc3)C12C#N |
| InChI | InChI=1S/C20H25N5O2/c1-3-5-10-26-20(27-11-6-4-2)19(14-22)16(15-8-7-9-24-12-15)18(19,13-21)17(23)25-20/h7-9,12,16H,3-6,10-11H2,1-2H3,(H2,23,25) |
| InChIKey | VMPPCKCSYOMPSR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|