C23H31N5O2 — CID 3371466
2-amino-4,4-dibutoxy-6-[4-(dimethylamino)phenyl]-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3371466) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-amino-4,4-dibutoxy-6-[4-(dimethylamino)phenyl]-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-dibutoxy-6-[4-(dimethylamino)phenyl]-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3371466 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-amino-4,4-dibutoxy-6-[4-(dimethylamino)phenyl]-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCOC1(OCCCC)N=C(N)C2(C#N)C(c3ccc(N(C)C)cc3)C12C#N |
| InChI | InChI=1S/C23H31N5O2/c1-5-7-13-29-23(30-14-8-6-2)22(16-25)19(21(22,15-24)20(26)27-23)17-9-11-18(12-10-17)28(3)4/h9-12,19H,5-8,13-14H2,1-4H3,(H2,26,27) |
| InChIKey | JZAGCFUZACSXHF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|