C23H30N4O2 — CID 3374699
2-amino-4,4-dibutoxy-6-(2,5-dimethylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3374699) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-amino-4,4-dibutoxy-6-(2,5-dimethylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-dibutoxy-6-(2,5-dimethylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3374699 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-amino-4,4-dibutoxy-6-(2,5-dimethylphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCOC1(OCCCC)N=C(N)C2(C#N)C(c3cc(C)ccc3C)C12C#N |
| InChI | InChI=1S/C23H30N4O2/c1-5-7-11-28-23(29-12-8-6-2)22(15-25)19(21(22,14-24)20(26)27-23)18-13-16(3)9-10-17(18)4/h9-10,13,19H,5-8,11-12H2,1-4H3,(H2,26,27) |
| InChIKey | GLSYDLBWOFKKGP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|