C21H24BrFN4O2 — CID 3375477
2-amino-6-(3-bromo-4-fluorophenyl)-4,4-dibutoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3375477) has the molecular formula C21H24BrFN4O2 and a molecular weight of 463.35 g/mol. Its IUPAC name is 2-amino-6-(3-bromo-4-fluorophenyl)-4,4-dibutoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-6-(3-bromo-4-fluorophenyl)-4,4-dibutoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3375477 |
| Molecular Formula | C21H24BrFN4O2 |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-amino-6-(3-bromo-4-fluorophenyl)-4,4-dibutoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCOC1(OCCCC)N=C(N)C2(C#N)C(c3ccc(F)c(Br)c3)C12C#N |
| InChI | InChI=1S/C21H24BrFN4O2/c1-3-5-9-28-21(29-10-6-4-2)20(13-25)17(19(20,12-24)18(26)27-21)14-7-8-16(23)15(22)11-14/h7-8,11,17H,3-6,9-10H2,1-2H3,(H2,26,27) |
| InChIKey | CZHVWAVXLOWYFE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|