C21H27N5O2 — CID 3371540
2-amino-6-[4-(diethylamino)phenyl]-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3371540) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-amino-6-[4-(diethylamino)phenyl]-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-6-[4-(diethylamino)phenyl]-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3371540 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-amino-6-[4-(diethylamino)phenyl]-4,4-diethoxy-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCOC1(OCC)N=C(N)C2(C#N)C(c3ccc(N(CC)CC)cc3)C12C#N |
| InChI | InChI=1S/C21H27N5O2/c1-5-26(6-2)16-11-9-15(10-12-16)17-19(13-22)18(24)25-21(27-7-3,28-8-4)20(17,19)14-23/h9-12,17H,5-8H2,1-4H3,(H2,24,25) |
| InChIKey | QMMVFHIEGZNANU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|