C20H24N4O3S2 — CID 3384480
2-amino-4,4-bis(ethylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3384480) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2-amino-4,4-bis(ethylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-bis(ethylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3384480 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-amino-4,4-bis(ethylsulfanyl)-6-(2,4,6-trimethoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCSC1(SCC)N=C(N)C2(C#N)C(c3c(OC)cc(OC)cc3OC)C12C#N |
| InChI | InChI=1S/C20H24N4O3S2/c1-6-28-20(29-7-2)19(11-22)16(18(19,10-21)17(23)24-20)15-13(26-4)8-12(25-3)9-14(15)27-5/h8-9,16H,6-7H2,1-5H3,(H2,23,24) |
| InChIKey | UBXGIKYZWYLIOS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|