C27H30N4OS2 — CID 3365144
2-amino-4,4-bis(butylsulfanyl)-6-(3-phenoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3365144) has the molecular formula C27H30N4OS2 and a molecular weight of 490.70 g/mol. Its IUPAC name is 2-amino-4,4-bis(butylsulfanyl)-6-(3-phenoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-4,4-bis(butylsulfanyl)-6-(3-phenoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3365144 |
| Molecular Formula | C27H30N4OS2 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-amino-4,4-bis(butylsulfanyl)-6-(3-phenoxyphenyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCCSC1(SCCCC)N=C(N)C2(C#N)C(c3cccc(Oc4ccccc4)c3)C12C#N |
| InChI | InChI=1S/C27H30N4OS2/c1-3-5-15-33-27(34-16-6-4-2)26(19-29)23(25(26,18-28)24(30)31-27)20-11-10-14-22(17-20)32-21-12-8-7-9-13-21/h7-14,17,23H,3-6,15-16H2,1-2H3,(H2,30,31) |
| InChIKey | SIDQFSVQPAYAQA-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|