C20H28N4S2 — CID 22489753
(1S,2S,6R,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile (PubChem CID 22489753) has the molecular formula C20H28N4S2 and a molecular weight of 388.61 g/mol. Its IUPAC name is (1S,2S,6R,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile.
| Compound Name | (1S,2S,6R,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 22489753 |
| Molecular Formula | C20H28N4S2 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (1S,2S,6R,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
| SMILES | CCCCSC1(SCCCC)N=C(N)[C@@]2(C#N)[C@@H]3C=C[C@H](CC3)[C@@]12C#N |
| InChI | InChI=1S/C20H28N4S2/c1-3-5-11-25-20(26-12-6-4-2)19(14-22)16-9-7-15(8-10-16)18(19,13-21)17(23)24-20/h7,9,15-16H,3-6,8,10-12H2,1-2H3,(H2,23,24)/t15-,16-,18-,19-/m1/s1 |
| InChIKey | IKXHYTTVFRPNQZ-PSBWJHGTSA-N |
| XLogP | 4.69 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|