C20H29N4S2+ — CID 7460646
(1R,2S,6S,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile (PubChem CID 7460646) has the molecular formula C20H29N4S2+ and a molecular weight of 389.61 g/mol. Its IUPAC name is (1R,2S,6S,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile.
| Compound Name | (1R,2S,6S,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 7460646 |
| Molecular Formula | C20H29N4S2+ |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (1R,2S,6S,7S)-3-amino-5,5-bis(butylsulfanyl)-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
| SMILES | CCCCSC1(SCCCC)[NH+]=C(N)[C@@]2(C#N)[C@H]3C=C[C@H](CC3)[C@]12C#N |
| InChI | InChI=1S/C20H28N4S2/c1-3-5-11-25-20(26-12-6-4-2)19(14-22)16-9-7-15(8-10-16)18(19,13-21)17(23)24-20/h7,9,15-16H,3-6,8,10-12H2,1-2H3,(H2,23,24)/p+1/t15-,16+,18+,19-/m0/s1 |
| InChIKey | IKXHYTTVFRPNQZ-ISARSNTHSA-O |
| XLogP | 2.77 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|