C16H15N4O2S+ — CID 7099615
(1'S,5'R,6'R)-2'-amino-6'-(4-methylsulfanylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 7099615) has the molecular formula C16H15N4O2S+ and a molecular weight of 327.39 g/mol. Its IUPAC name is (1'S,5'R,6'R)-2'-amino-6'-(4-methylsulfanylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,5'R,6'R)-2'-amino-6'-(4-methylsulfanylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 7099615 |
| Molecular Formula | C16H15N4O2S+ |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (1'S,5'R,6'R)-2'-amino-6'-(4-methylsulfanylphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | CSc1ccc([C@@H]2[C@]3(C#N)C(N)=[NH+]C4(OCCO4)[C@]23C#N)cc1 |
| InChI | InChI=1S/C16H14N4O2S/c1-23-11-4-2-10(3-5-11)12-14(8-17)13(19)20-16(15(12,14)9-18)21-6-7-22-16/h2-5,12H,6-7H2,1H3,(H2,19,20)/p+1/t12-,14-,15-/m1/s1 |
| InChIKey | GHMAZSADYOAIQY-BPLDGKMQSA-O |
| XLogP | -0.32 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |