C18H19N4O5+ — CID 7127486
(1'S,5'R,6'R)-2'-amino-6'-(2,3,4-trimethoxyphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 7127486) has the molecular formula C18H19N4O5+ and a molecular weight of 371.37 g/mol. Its IUPAC name is (1'S,5'R,6'R)-2'-amino-6'-(2,3,4-trimethoxyphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,5'R,6'R)-2'-amino-6'-(2,3,4-trimethoxyphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 7127486 |
| Molecular Formula | C18H19N4O5+ |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (1'S,5'R,6'R)-2'-amino-6'-(2,3,4-trimethoxyphenyl)spiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | COc1ccc([C@H]2[C@]3(C#N)C(N)=[NH+]C4(OCCO4)[C@]23C#N)c(OC)c1OC |
| InChI | InChI=1S/C18H18N4O5/c1-23-11-5-4-10(12(24-2)13(11)25-3)14-16(8-19)15(21)22-18(17(14,16)9-20)26-6-7-27-18/h4-5,14H,6-7H2,1-3H3,(H2,21,22)/p+1/t14-,16+,17+/m0/s1 |
| InChIKey | RYMNKCAFNMMHNN-USXIJHARSA-O |
| XLogP | -1.02 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |