C15H10N4O2 — CID 3352702
3-(2,3-dimethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile (PubChem CID 3352702) has the molecular formula C15H10N4O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-(2,3-dimethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 3352702 |
| Molecular Formula | C15H10N4O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)cyclopropane-1,1,2,2-tetracarbonitrile |
| SMILES | COc1cccc(C2C(C#N)(C#N)C2(C#N)C#N)c1OC |
| InChI | InChI=1S/C15H10N4O2/c1-20-11-5-3-4-10(12(11)21-2)13-14(6-16,7-17)15(13,8-18)9-19/h3-5,13H,1-2H3 |
| InChIKey | QSWUFIWBJGOTDG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|