C14H9N3O3 — CID 8607007
(1R,5S)-6-(2-methoxyphenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile (PubChem CID 8607007) has the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. Its IUPAC name is (1R,5S)-6-(2-methoxyphenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile.
| Compound Name | (1R,5S)-6-(2-methoxyphenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 8607007 |
| Molecular Formula | C14H9N3O3 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (1R,5S)-6-(2-methoxyphenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
| SMILES | COc1ccccc1C1[C@]2(C#N)C(=O)NC(=O)[C@]12C#N |
| InChI | InChI=1S/C14H9N3O3/c1-20-9-5-3-2-4-8(9)10-13(6-15)11(18)17-12(19)14(10,13)7-16/h2-5,10H,1H3,(H,17,18,19)/t10?,13-,14+ |
| InChIKey | YSIKKUHDVPIYDR-FTNCPSPGSA-N |
| XLogP | 0.47 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|