C28H22N2O2 — CID 56949788
cis-(2R,3E,6S)-3-benzylidene-2-(2-methoxyphenyl)-4-oxo-6-phenylcyclohexane-1,1-dicarbonitrile (PubChem CID 56949788) has the molecular formula C28H22N2O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is cis-(2R,3E,6S)-3-benzylidene-2-(2-methoxyphenyl)-4-oxo-6-phenylcyclohexane-1,1-dicarbonitrile.
| Compound Name | cis-(2R,3E,6S)-3-benzylidene-2-(2-methoxyphenyl)-4-oxo-6-phenylcyclohexane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 56949788 |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | cis-(2R,3E,6S)-3-benzylidene-2-(2-methoxyphenyl)-4-oxo-6-phenylcyclohexane-1,1-dicarbonitrile |
| SMILES | COc1ccccc1[C@@H]1/C(=C\c2ccccc2)C(=O)C[C@@H](c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C28H22N2O2/c1-32-26-15-9-8-14-22(26)27-23(16-20-10-4-2-5-11-20)25(31)17-24(28(27,18-29)19-30)21-12-6-3-7-13-21/h2-16,24,27H,17H2,1H3/b23-16-/t24-,27+/m0/s1 |
| InChIKey | TUWHZLHKVKEPMV-QJGHKKGGSA-N |
| XLogP | 5.65 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|