C13H11N4O2S+ — CID 8608317
(1'S,5'R,6'S)-2'-amino-6'-thiophen-2-ylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8608317) has the molecular formula C13H11N4O2S+ and a molecular weight of 287.32 g/mol. Its IUPAC name is (1'S,5'R,6'S)-2'-amino-6'-thiophen-2-ylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,5'R,6'S)-2'-amino-6'-thiophen-2-ylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8608317 |
| Molecular Formula | C13H11N4O2S+ |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (1'S,5'R,6'S)-2'-amino-6'-thiophen-2-ylspiro[1,3-dioxolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | N#C[C@@]12C(N)=[NH+]C3(OCCO3)[C@]1(C#N)[C@H]2c1cccs1 |
| InChI | InChI=1S/C13H10N4O2S/c14-6-11-9(8-2-1-5-20-8)12(11,7-15)13(17-10(11)16)18-3-4-19-13/h1-2,5,9H,3-4H2,(H2,16,17)/p+1/t9-,11+,12+/m0/s1 |
| InChIKey | TYEODQLXXBHDIC-MVWJERBFSA-O |
| XLogP | -0.98 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |