C14H10N2S2 — CID 102094708
(1S,2R,3R,4R)-3,4-dithiophen-2-ylcyclobutane-1,2-dicarbonitrile (PubChem CID 102094708) has the molecular formula C14H10N2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3,4-dithiophen-2-ylcyclobutane-1,2-dicarbonitrile.
| Compound Name | (1S,2R,3R,4R)-3,4-dithiophen-2-ylcyclobutane-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 102094708 |
| Molecular Formula | C14H10N2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (1S,2R,3R,4R)-3,4-dithiophen-2-ylcyclobutane-1,2-dicarbonitrile |
| SMILES | N#C[C@@H]1[C@H](C#N)[C@@H](c2cccs2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C14H10N2S2/c15-7-9-10(8-16)14(12-4-2-6-18-12)13(9)11-3-1-5-17-11/h1-6,9-10,13-14H/t9-,10+,13-,14-/m0/s1 |
| InChIKey | PBNQBSISQIRXTR-DJBIQUGXSA-N |
| XLogP | 3.97 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |