C7H9NS — CID 28901769
cis-(1R,2S)-2-thiophen-2-ylcyclopropan-1-amine (PubChem CID 28901769) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is cis-(1R,2S)-2-thiophen-2-ylcyclopropan-1-amine.
| Compound Name | cis-(1R,2S)-2-thiophen-2-ylcyclopropan-1-amine |
|---|---|
| PubChem CID | 28901769 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | cis-(1R,2S)-2-thiophen-2-ylcyclopropan-1-amine |
| SMILES | N[C@@H]1C[C@@H]1c1cccs1 |
| InChI | InChI=1S/C7H9NS/c8-6-4-5(6)7-2-1-3-9-7/h1-3,5-6H,4,8H2/t5-,6+/m0/s1 |
| InChIKey | VVGLOBBDGMVHNZ-NTSWFWBYSA-N |
| XLogP | 1.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |