C12H19NS — CID 165491959
N,4-dimethyl-3-thiophen-2-ylcyclohexan-1-amine (PubChem CID 165491959) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is N,4-dimethyl-3-thiophen-2-ylcyclohexan-1-amine.
| Compound Name | N,4-dimethyl-3-thiophen-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 165491959 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N,4-dimethyl-3-thiophen-2-ylcyclohexan-1-amine |
| SMILES | CNC1CCC(C)C(c2cccs2)C1 |
| InChI | InChI=1S/C12H19NS/c1-9-5-6-10(13-2)8-11(9)12-4-3-7-14-12/h3-4,7,9-11,13H,5-6,8H2,1-2H3 |
| InChIKey | ARQFAMGZFQEVKZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |