C9H13NOS — CID 69452815
(3R,4S)-4-thiophen-2-ylpiperidin-3-ol (PubChem CID 69452815) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is (3R,4S)-4-thiophen-2-ylpiperidin-3-ol.
| Compound Name | (3R,4S)-4-thiophen-2-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 69452815 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (3R,4S)-4-thiophen-2-ylpiperidin-3-ol |
| SMILES | O[C@H]1CNCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C9H13NOS/c11-8-6-10-4-3-7(8)9-2-1-5-12-9/h1-2,5,7-8,10-11H,3-4,6H2/t7-,8-/m0/s1 |
| InChIKey | MJSFZFPAUSARQI-YUMQZZPRSA-N |
| XLogP | 1.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |