C10H15NS — CID 81417579
N,2-dimethyl-3-thiophen-2-ylcyclobutan-1-amine (PubChem CID 81417579) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is N,2-dimethyl-3-thiophen-2-ylcyclobutan-1-amine.
| Compound Name | N,2-dimethyl-3-thiophen-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 81417579 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N,2-dimethyl-3-thiophen-2-ylcyclobutan-1-amine |
| SMILES | CNC1CC(c2cccs2)C1C |
| InChI | InChI=1S/C10H15NS/c1-7-8(6-9(7)11-2)10-4-3-5-12-10/h3-5,7-9,11H,6H2,1-2H3 |
| InChIKey | LSRMIRGQEGFGFQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |