C12H13NO2S3 — CID 110711304
5-methyl-N-(2-thiophen-2-ylcyclopropyl)thiophene-2-sulfonamide (PubChem CID 110711304) has the molecular formula C12H13NO2S3 and a molecular weight of 299.44 g/mol. Its IUPAC name is 5-methyl-N-(2-thiophen-2-ylcyclopropyl)thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-(2-thiophen-2-ylcyclopropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110711304 |
| Molecular Formula | C12H13NO2S3 |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 5-methyl-N-(2-thiophen-2-ylcyclopropyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2c2cccs2)s1 |
| InChI | InChI=1S/C12H13NO2S3/c1-8-4-5-12(17-8)18(14,15)13-10-7-9(10)11-3-2-6-16-11/h2-6,9-10,13H,7H2,1H3 |
| InChIKey | WYJIWXCNFWGPIX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |