C9H13NOS — CID 79365694
2-thiophen-2-yloxan-3-amine (PubChem CID 79365694) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-thiophen-2-yloxan-3-amine.
| Compound Name | 2-thiophen-2-yloxan-3-amine |
|---|---|
| PubChem CID | 79365694 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2-thiophen-2-yloxan-3-amine |
| SMILES | NC1CCCOC1c1cccs1 |
| InChI | InChI=1S/C9H13NOS/c10-7-3-1-5-11-9(7)8-4-2-6-12-8/h2,4,6-7,9H,1,3,5,10H2 |
| InChIKey | XXGJQRRVJMSCNM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |