C10H16NOS+ — CID 7129182
[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 7129182) has the molecular formula C10H16NOS+ and a molecular weight of 198.31 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7129182 |
| Molecular Formula | C10H16NOS+ |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | c1csc(C[NH2+]C[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C10H15NOS/c1-3-9(12-5-1)7-11-8-10-4-2-6-13-10/h2,4,6,9,11H,1,3,5,7-8H2/p+1/t9-/m0/s1 |
| InChIKey | XLBLINMXRABVKF-VIFPVBQESA-O |
| XLogP | 0.99 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |