C13H17F3NO+ — CID 7298330
[(2S)-oxolan-2-yl]methyl-[[2-(trifluoromethyl)phenyl]methyl]azanium (PubChem CID 7298330) has the molecular formula C13H17F3NO+ and a molecular weight of 260.28 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl-[[2-(trifluoromethyl)phenyl]methyl]azanium.
| Compound Name | [(2S)-oxolan-2-yl]methyl-[[2-(trifluoromethyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 7298330 |
| Molecular Formula | C13H17F3NO+ |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl-[[2-(trifluoromethyl)phenyl]methyl]azanium |
| SMILES | FC(F)(F)c1ccccc1C[NH2+]C[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H16F3NO/c14-13(15,16)12-6-2-1-4-10(12)8-17-9-11-5-3-7-18-11/h1-2,4,6,11,17H,3,5,7-9H2/p+1/t11-/m0/s1 |
| InChIKey | QMVUFIUACWHVEH-NSHDSACASA-O |
| XLogP | 1.95 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |