C14H22NO3+ — CID 6942240
(2,4-dimethoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 6942240) has the molecular formula C14H22NO3+ and a molecular weight of 252.33 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | (2,4-dimethoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 6942240 |
| Molecular Formula | C14H22NO3+ |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | COc1ccc(C[NH2+]C[C@H]2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C14H21NO3/c1-16-12-6-5-11(14(8-12)17-2)9-15-10-13-4-3-7-18-13/h5-6,8,13,15H,3-4,7,9-10H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | UMUVEGLNWVUCTM-CYBMUJFWSA-O |
| XLogP | 0.95 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |