C14H22NO3+ — CID 2430826
2-(2-methoxyphenoxy)ethyl-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 2430826) has the molecular formula C14H22NO3+ and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)ethyl-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | 2-(2-methoxyphenoxy)ethyl-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 2430826 |
| Molecular Formula | C14H22NO3+ |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-(2-methoxyphenoxy)ethyl-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | COc1ccccc1OCC[NH2+]C[C@H]1CCCO1 |
| InChI | InChI=1S/C14H21NO3/c1-16-13-6-2-3-7-14(13)18-10-8-15-11-12-5-4-9-17-12/h2-3,6-7,12,15H,4-5,8-11H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | UVJQBHRCKMVDEU-GFCCVEGCSA-O |
| XLogP | 0.82 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|