C21H25NO4S — CID 46562523
N-[2-(2-methoxyphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide (PubChem CID 46562523) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 46562523 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1ccccc1SCC1CCCO1 |
| InChI | InChI=1S/C21H25NO4S/c1-24-18-9-3-4-10-19(18)26-14-12-22-21(23)17-8-2-5-11-20(17)27-15-16-7-6-13-25-16/h2-5,8-11,16H,6-7,12-15H2,1H3,(H,22,23) |
| InChIKey | ZGBOUVNJXQGWJZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|