C20H23NO3S — CID 9400725
N-[(4-methoxyphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide (PubChem CID 9400725) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 9400725 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2SC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-23-16-10-8-15(9-11-16)13-21-20(22)18-6-2-3-7-19(18)25-14-17-5-4-12-24-17/h2-3,6-11,17H,4-5,12-14H2,1H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | IKTMHWRUTGSARN-QGZVFWFLSA-N |
| XLogP | 3.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |