C22H26N2O3S — CID 55724333
N-[[3-(ethylcarbamoyl)phenyl]methyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide (PubChem CID 55724333) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[[3-(ethylcarbamoyl)phenyl]methyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[[3-(ethylcarbamoyl)phenyl]methyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55724333 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[[3-(ethylcarbamoyl)phenyl]methyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
| SMILES | CCNC(=O)c1cccc(CNC(=O)c2ccccc2SCC2CCCO2)c1 |
| InChI | InChI=1S/C22H26N2O3S/c1-2-23-21(25)17-8-5-7-16(13-17)14-24-22(26)19-10-3-4-11-20(19)28-15-18-9-6-12-27-18/h3-5,7-8,10-11,13,18H,2,6,9,12,14-15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | FLDIKDMAPCVGDN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |