C9H12O2S — CID 61087499
oxolan-2-yl(thiophen-2-yl)methanol (PubChem CID 61087499) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is oxolan-2-yl(thiophen-2-yl)methanol.
| Compound Name | oxolan-2-yl(thiophen-2-yl)methanol |
|---|---|
| PubChem CID | 61087499 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | oxolan-2-yl(thiophen-2-yl)methanol |
| SMILES | OC(c1cccs1)C1CCCO1 |
| InChI | InChI=1S/C9H12O2S/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h2,4,6-7,9-10H,1,3,5H2 |
| InChIKey | YXNVVNCIKKJRNH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |