C13H21NO2S — CID 114135927
2-[2-(oxan-2-yl)ethylamino]-1-thiophen-2-ylethanol (PubChem CID 114135927) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 2-[2-(oxan-2-yl)ethylamino]-1-thiophen-2-ylethanol.
| Compound Name | 2-[2-(oxan-2-yl)ethylamino]-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 114135927 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[2-(oxan-2-yl)ethylamino]-1-thiophen-2-ylethanol |
| SMILES | OC(CNCCC1CCCCO1)c1cccs1 |
| InChI | InChI=1S/C13H21NO2S/c15-12(13-5-3-9-17-13)10-14-7-6-11-4-1-2-8-16-11/h3,5,9,11-12,14-15H,1-2,4,6-8,10H2 |
| InChIKey | GTSGDEHDQSUYPS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|