C12H19NO2S — CID 61020491
2-(oxan-3-ylmethylamino)-1-thiophen-2-ylethanol (PubChem CID 61020491) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-(oxan-3-ylmethylamino)-1-thiophen-2-ylethanol.
| Compound Name | 2-(oxan-3-ylmethylamino)-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 61020491 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-(oxan-3-ylmethylamino)-1-thiophen-2-ylethanol |
| SMILES | OC(CNCC1CCCOC1)c1cccs1 |
| InChI | InChI=1S/C12H19NO2S/c14-11(12-4-2-6-16-12)8-13-7-10-3-1-5-15-9-10/h2,4,6,10-11,13-14H,1,3,5,7-9H2 |
| InChIKey | WULVUKNIVXHEQR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |