C15H23NO4S — CID 61019335
1-(4-methylsulfonylphenyl)-2-(oxan-3-ylmethylamino)ethanol (PubChem CID 61019335) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-2-(oxan-3-ylmethylamino)ethanol.
| Compound Name | 1-(4-methylsulfonylphenyl)-2-(oxan-3-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 61019335 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-2-(oxan-3-ylmethylamino)ethanol |
| SMILES | CS(=O)(=O)c1ccc(C(O)CNCC2CCCOC2)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-21(18,19)14-6-4-13(5-7-14)15(17)10-16-9-12-3-2-8-20-11-12/h4-7,12,15-17H,2-3,8-11H2,1H3 |
| InChIKey | MTJYGNIYEHOABM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |