C17H25NO3S — CID 111382017
2-[bis(cyclopropylmethyl)amino]-1-(4-methylsulfonylphenyl)ethanol (PubChem CID 111382017) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-[bis(cyclopropylmethyl)amino]-1-(4-methylsulfonylphenyl)ethanol.
| Compound Name | 2-[bis(cyclopropylmethyl)amino]-1-(4-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 111382017 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[bis(cyclopropylmethyl)amino]-1-(4-methylsulfonylphenyl)ethanol |
| SMILES | CS(=O)(=O)c1ccc(C(O)CN(CC2CC2)CC2CC2)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-22(20,21)16-8-6-15(7-9-16)17(19)12-18(10-13-2-3-13)11-14-4-5-14/h6-9,13-14,17,19H,2-5,10-12H2,1H3 |
| InChIKey | LUQVTTLGQQWVPT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |