C15H23NO2S — CID 111858466
2-[1-(oxolan-2-ylmethyl)pyrrolidin-2-yl]-1-thiophen-2-ylethanol (PubChem CID 111858466) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-[1-(oxolan-2-ylmethyl)pyrrolidin-2-yl]-1-thiophen-2-ylethanol.
| Compound Name | 2-[1-(oxolan-2-ylmethyl)pyrrolidin-2-yl]-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 111858466 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[1-(oxolan-2-ylmethyl)pyrrolidin-2-yl]-1-thiophen-2-ylethanol |
| SMILES | OC(CC1CCCN1CC1CCCO1)c1cccs1 |
| InChI | InChI=1S/C15H23NO2S/c17-14(15-6-3-9-19-15)10-12-4-1-7-16(12)11-13-5-2-8-18-13/h3,6,9,12-14,17H,1-2,4-5,7-8,10-11H2 |
| InChIKey | TZNUZPTVMCIQNE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |