C17H21NO2S2 — CID 122137801
1-[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one (PubChem CID 122137801) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 122137801 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one |
| SMILES | CC(C(=O)N1CCCC1CC(O)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H21NO2S2/c1-12(15-6-3-9-21-15)17(20)18-8-2-5-13(18)11-14(19)16-7-4-10-22-16/h3-4,6-7,9-10,12-14,19H,2,5,8,11H2,1H3 |
| InChIKey | OXSWYCIYQMNIHA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |