C13H21ClN2OS — CID 119649918
1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one;hydrochloride (PubChem CID 119649918) has the molecular formula C13H21ClN2OS and a molecular weight of 288.84 g/mol. Its IUPAC name is 1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one;hydrochloride.
| Compound Name | 1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119649918 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[2-(methylaminomethyl)pyrrolidin-1-yl]-2-thiophen-2-ylpropan-1-one;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)C(C)c1cccs1.Cl |
| InChI | InChI=1S/C13H20N2OS.ClH/c1-10(12-6-4-8-17-12)13(16)15-7-3-5-11(15)9-14-2;/h4,6,8,10-11,14H,3,5,7,9H2,1-2H3;1H |
| InChIKey | GRSQOCWGALIDIF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |