C14H24ClN3OS — CID 119928547
2-[2-(methylaminomethyl)pyrrolidin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide;hydrochloride (PubChem CID 119928547) has the molecular formula C14H24ClN3OS and a molecular weight of 317.89 g/mol. Its IUPAC name is 2-[2-(methylaminomethyl)pyrrolidin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(methylaminomethyl)pyrrolidin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119928547 |
| Molecular Formula | C14H24ClN3OS |
| Molecular Weight | 317.89 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[2-(methylaminomethyl)pyrrolidin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide;hydrochloride |
| SMILES | CNCC1CCCN1CC(=O)NC(C)c1cccs1.Cl |
| InChI | InChI=1S/C14H23N3OS.ClH/c1-11(13-6-4-8-19-13)16-14(18)10-17-7-3-5-12(17)9-15-2;/h4,6,8,11-12,15H,3,5,7,9-10H2,1-2H3,(H,16,18);1H |
| InChIKey | FNGXLZUTEFNGKY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.89 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |