C16H22N4OS — CID 95609320
2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]-N-[(1R)-1-thiophen-2-ylethyl]acetamide (PubChem CID 95609320) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]-N-[(1R)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 95609320 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]-N-[(1R)-1-thiophen-2-ylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CN1CCC[C@@H]1Cn1cccn1)c1cccs1 |
| InChI | InChI=1S/C16H22N4OS/c1-13(15-6-3-10-22-15)18-16(21)12-19-8-2-5-14(19)11-20-9-4-7-17-20/h3-4,6-7,9-10,13-14H,2,5,8,11-12H2,1H3,(H,18,21)/t13-,14-/m1/s1 |
| InChIKey | NWVBJOGZCCHHEJ-ZIAGYGMSSA-N |
| XLogP | 2.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |