C14H20N2O4S — CID 122018652
3-[[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidine-1-carbonyl]amino]propanoic acid (PubChem CID 122018652) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-[[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidine-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122018652 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-[[2-(2-hydroxy-2-thiophen-2-ylethyl)pyrrolidine-1-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N1CCCC1CC(O)c1cccs1 |
| InChI | InChI=1S/C14H20N2O4S/c17-11(12-4-2-8-21-12)9-10-3-1-7-16(10)14(20)15-6-5-13(18)19/h2,4,8,10-11,17H,1,3,5-7,9H2,(H,15,20)(H,18,19) |
| InChIKey | CXUHPOKOPAQAGY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |