About 3-thiophen-2-yl-1,5-dithiocane
3-thiophen-2-yl-1,5-dithiocane (PubChem CID 20737216) has the molecular formula C10H14S3
and a molecular weight of 230.42 g/mol. Its IUPAC name is 3-thiophen-2-yl-1,5-dithiocane.
Molecular Properties
| Compound Name | 3-thiophen-2-yl-1,5-dithiocane |
| PubChem CID | 20737216 |
| Molecular Formula | C10H14S3 |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-thiophen-2-yl-1,5-dithiocane |
| SMILES | c1csc(C2CSCCCSC2)c1 |
| InChI | InChI=1S/C10H14S3/c1-3-10(13-6-1)9-7-11-4-2-5-12-8-9/h1,3,6,9H,2,4-5,7-8H2 |
| InChIKey | ZLTKJHDWCBSFEH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thiophen-2-yl-1,5-dithiocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-1,5-dithiocane?
The IUPAC name of 3-thiophen-2-yl-1,5-dithiocane (CID 20737216) is 3-thiophen-2-yl-1,5-dithiocane.
What is the SMILES notation for 3-thiophen-2-yl-1,5-dithiocane?
The canonical SMILES for 3-thiophen-2-yl-1,5-dithiocane is c1csc(C2CSCCCSC2)c1.
What is the InChIKey of 3-thiophen-2-yl-1,5-dithiocane?
The InChIKey is ZLTKJHDWCBSFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S3/c1-3-10(13-6-1)9-7-11-4-2-5-12-8-9/h1,3,6,9H,2,4-5,7-8H2.
What are the key properties of 3-thiophen-2-yl-1,5-dithiocane?
3-thiophen-2-yl-1,5-dithiocane has a molecular weight of 230.42 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-1,5-dithiocane is sourced from PubChem (CID 20737216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).