C19H30S — CID 143775690
2-[4-(4-propylcyclohexyl)cyclohexyl]thiophene (PubChem CID 143775690) has the molecular formula C19H30S and a molecular weight of 290.52 g/mol. Its IUPAC name is 2-[4-(4-propylcyclohexyl)cyclohexyl]thiophene.
| Compound Name | 2-[4-(4-propylcyclohexyl)cyclohexyl]thiophene |
|---|---|
| PubChem CID | 143775690 |
| Molecular Formula | C19H30S |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-[4-(4-propylcyclohexyl)cyclohexyl]thiophene |
| SMILES | CCCC1CCC(C2CCC(c3cccs3)CC2)CC1 |
| InChI | InChI=1S/C19H30S/c1-2-4-15-6-8-16(9-7-15)17-10-12-18(13-11-17)19-5-3-14-20-19/h3,5,14-18H,2,4,6-13H2,1H3 |
| InChIKey | TVAKYXSHPZLUAR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |