C18H12O2S4 — CID 101164695
(1R,5S,6S,7R)-3-(1,3-dithiol-2-ylidene)-6,7-dithiophen-2-ylbicyclo[3.2.0]heptane-2,4-dione (PubChem CID 101164695) has the molecular formula C18H12O2S4 and a molecular weight of 388.56 g/mol. Its IUPAC name is (1R,5S,6S,7R)-3-(1,3-dithiol-2-ylidene)-6,7-dithiophen-2-ylbicyclo[3.2.0]heptane-2,4-dione.
| Compound Name | (1R,5S,6S,7R)-3-(1,3-dithiol-2-ylidene)-6,7-dithiophen-2-ylbicyclo[3.2.0]heptane-2,4-dione |
|---|---|
| PubChem CID | 101164695 |
| Molecular Formula | C18H12O2S4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | (1R,5S,6S,7R)-3-(1,3-dithiol-2-ylidene)-6,7-dithiophen-2-ylbicyclo[3.2.0]heptane-2,4-dione |
| SMILES | O=C1C(=C2SC=CS2)C(=O)[C@H]2[C@@H]1[C@@H](c1cccs1)[C@H]2c1cccs1 |
| InChI | InChI=1S/C18H12O2S4/c19-16-13-11(9-3-1-5-21-9)12(10-4-2-6-22-10)14(13)17(20)15(16)18-23-7-8-24-18/h1-8,11-14H/t11-,12+,13-,14+ |
| InChIKey | QWPIRANRUMJHSH-KPWCQOOUSA-N |
| XLogP | 5.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|