C15H11ClN5O3S+ — CID 8607507
(1'S,2R,5'R,6'S)-2'-amino-6'-(2-chloro-4-nitrophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 8607507) has the molecular formula C15H11ClN5O3S+ and a molecular weight of 376.81 g/mol. Its IUPAC name is (1'S,2R,5'R,6'S)-2'-amino-6'-(2-chloro-4-nitrophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(2-chloro-4-nitrophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 8607507 |
| Molecular Formula | C15H11ClN5O3S+ |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (1'S,2R,5'R,6'S)-2'-amino-6'-(2-chloro-4-nitrophenyl)spiro[1,3-oxathiolane-2,4'-3-azoniabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | N#C[C@@]12[C@@H](c3ccc([N+](=O)[O-])cc3Cl)[C@]1(C#N)C(N)=[NH+][C@@]21OCCS1 |
| InChI | InChI=1S/C15H10ClN5O3S/c16-10-5-8(21(22)23)1-2-9(10)11-13(6-17)12(19)20-15(14(11,13)7-18)24-3-4-25-15/h1-2,5,11H,3-4H2,(H2,19,20)/p+1/t11-,13+,14+,15+/m0/s1 |
| InChIKey | OLMWUUVZZZMJMQ-ZGKBOVNRSA-O |
| XLogP | 0.23 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|