C15H13ClN5O4+ — CID 7321933
(1S,5R,6R)-2-amino-6-(2-chloro-5-nitrophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 7321933) has the molecular formula C15H13ClN5O4+ and a molecular weight of 362.75 g/mol. Its IUPAC name is (1S,5R,6R)-2-amino-6-(2-chloro-5-nitrophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5R,6R)-2-amino-6-(2-chloro-5-nitrophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 7321933 |
| Molecular Formula | C15H13ClN5O4+ |
| Molecular Weight | 362.75 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (1S,5R,6R)-2-amino-6-(2-chloro-5-nitrophenyl)-4,4-dimethoxy-3-azoniabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | COC1(OC)[NH+]=C(N)[C@@]2(C#N)[C@@H](c3cc([N+](=O)[O-])ccc3Cl)[C@@]12C#N |
| InChI | InChI=1S/C15H12ClN5O4/c1-24-15(25-2)14(7-18)11(13(14,6-17)12(19)20-15)9-5-8(21(22)23)3-4-10(9)16/h3-5,11H,1-2H3,(H2,19,20)/p+1/t11-,13-,14-/m1/s1 |
| InChIKey | KIBRMZOKICFEAU-MRVWCRGKSA-O |
| XLogP | -0.24 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.75 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|