C19H20ClN5O2S2 — CID 3381963
2-amino-6-(2-chloro-5-nitrophenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 3381963) has the molecular formula C19H20ClN5O2S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 2-amino-6-(2-chloro-5-nitrophenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | 2-amino-6-(2-chloro-5-nitrophenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 3381963 |
| Molecular Formula | C19H20ClN5O2S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-amino-6-(2-chloro-5-nitrophenyl)-4,4-bis(propylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCCSC1(SCCC)N=C(N)C2(C#N)C(c3cc([N+](=O)[O-])ccc3Cl)C12C#N |
| InChI | InChI=1S/C19H20ClN5O2S2/c1-3-7-28-19(29-8-4-2)18(11-22)15(17(18,10-21)16(23)24-19)13-9-12(25(26)27)5-6-14(13)20/h5-6,9,15H,3-4,7-8H2,1-2H3,(H2,23,24) |
| InChIKey | CHBHOWBLXIHBDN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|