C17H18ClN3O6 — CID 54120581
propyl 4-(2-chloro-5-nitrophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate (PubChem CID 54120581) has the molecular formula C17H18ClN3O6 and a molecular weight of 395.80 g/mol. Its IUPAC name is propyl 4-(2-chloro-5-nitrophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate.
| Compound Name | propyl 4-(2-chloro-5-nitrophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 54120581 |
| Molecular Formula | C17H18ClN3O6 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | propyl 4-(2-chloro-5-nitrophenyl)-2,6-dimethyl-3-nitro-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCCOC(=O)C1=C(C)N=C(C)C([N+](=O)[O-])C1c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H18ClN3O6/c1-4-7-27-17(22)14-9(2)19-10(3)16(21(25)26)15(14)12-8-11(20(23)24)5-6-13(12)18/h5-6,8,15-16H,4,7H2,1-3H3 |
| InChIKey | NNKLHKVDNHGANY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 124.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|