C22H19ClN4O4 — CID 132530564
ethyl (4R)-4-(2-chloro-5-nitrophenyl)-2-methyl-4,11-dihydro-1H-pyrido[2,3-b][1,5]benzodiazepine-3-carboxylate (PubChem CID 132530564) has the molecular formula C22H19ClN4O4 and a molecular weight of 438.87 g/mol. Its IUPAC name is ethyl (4R)-4-(2-chloro-5-nitrophenyl)-2-methyl-4,11-dihydro-1H-pyrido[2,3-b][1,5]benzodiazepine-3-carboxylate.
| Compound Name | ethyl (4R)-4-(2-chloro-5-nitrophenyl)-2-methyl-4,11-dihydro-1H-pyrido[2,3-b][1,5]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 132530564 |
| Molecular Formula | C22H19ClN4O4 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | ethyl (4R)-4-(2-chloro-5-nitrophenyl)-2-methyl-4,11-dihydro-1H-pyrido[2,3-b][1,5]benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C=Nc3ccccc3N2)[C@H]1c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H19ClN4O4/c1-3-31-22(28)19-12(2)25-21-15(11-24-17-6-4-5-7-18(17)26-21)20(19)14-10-13(27(29)30)8-9-16(14)23/h4-11,20,25-26H,3H2,1-2H3/t20-/m1/s1 |
| InChIKey | YRRZIQJMTZXQTA-HXUWFJFHSA-N |
| XLogP | 4.81 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|